C9H6ClF5N4O — CID 103076012
5-chloro-6-methyl-7-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 103076012) has the molecular formula C9H6ClF5N4O and a molecular weight of 316.62 g/mol. Its IUPAC name is 5-chloro-6-methyl-7-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 5-chloro-6-methyl-7-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 103076012 |
| Molecular Formula | C9H6ClF5N4O |
| Molecular Weight | 316.62 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 5-chloro-6-methyl-7-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1c(Cl)nc2ncnn2c1OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H6ClF5N4O/c1-4-5(10)18-7-16-3-17-19(7)6(4)20-2-8(11,12)9(13,14)15/h3H,2H2,1H3 |
| InChIKey | YXOPSXVLGADZHH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.62 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|