C9H5ClF6N4O — CID 103076044
5-chloro-7-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 103076044) has the molecular formula C9H5ClF6N4O and a molecular weight of 334.61 g/mol. Its IUPAC name is 5-chloro-7-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 5-chloro-7-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 103076044 |
| Molecular Formula | C9H5ClF6N4O |
| Molecular Weight | 334.61 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 5-chloro-7-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1c(Cl)nc2ncnn2c1OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H5ClF6N4O/c1-3-4(10)19-7-17-2-18-20(7)5(3)21-6(8(11,12)13)9(14,15)16/h2,6H,1H3 |
| InChIKey | CEMGBAWEUPUYPG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.61 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |