C9H9ClF3N5 — CID 103076289
5-chloro-N,6-dimethyl-N-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 103076289) has the molecular formula C9H9ClF3N5 and a molecular weight of 279.65 g/mol. Its IUPAC name is 5-chloro-N,6-dimethyl-N-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-chloro-N,6-dimethyl-N-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 103076289 |
| Molecular Formula | C9H9ClF3N5 |
| Molecular Weight | 279.65 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 5-chloro-N,6-dimethyl-N-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1c(Cl)nc2ncnn2c1N(C)CC(F)(F)F |
| InChI | InChI=1S/C9H9ClF3N5/c1-5-6(10)16-8-14-4-15-18(8)7(5)17(2)3-9(11,12)13/h4H,3H2,1-2H3 |
| InChIKey | OKSOQBGPMIKQEH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.65 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |