C15H24ClN5 — CID 103076803
5-chloro-N-(2,2-dimethylheptyl)-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 103076803) has the molecular formula C15H24ClN5 and a molecular weight of 309.85 g/mol. Its IUPAC name is 5-chloro-N-(2,2-dimethylheptyl)-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-chloro-N-(2,2-dimethylheptyl)-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 103076803 |
| Molecular Formula | C15H24ClN5 |
| Molecular Weight | 309.85 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 5-chloro-N-(2,2-dimethylheptyl)-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCCCCC(C)(C)CNc1c(C)c(Cl)nc2ncnn12 |
| InChI | InChI=1S/C15H24ClN5/c1-5-6-7-8-15(3,4)9-17-13-11(2)12(16)20-14-18-10-19-21(13)14/h10,17H,5-9H2,1-4H3 |
| InChIKey | MJJLHTAZKABMQV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.85 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|