C10H11ClF3N5 — CID 103076836
5-chloro-6-methyl-N-(4,4,4-trifluorobutyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 103076836) has the molecular formula C10H11ClF3N5 and a molecular weight of 293.68 g/mol. Its IUPAC name is 5-chloro-6-methyl-N-(4,4,4-trifluorobutyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-chloro-6-methyl-N-(4,4,4-trifluorobutyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 103076836 |
| Molecular Formula | C10H11ClF3N5 |
| Molecular Weight | 293.68 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 5-chloro-6-methyl-N-(4,4,4-trifluorobutyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1c(Cl)nc2ncnn2c1NCCCC(F)(F)F |
| InChI | InChI=1S/C10H11ClF3N5/c1-6-7(11)18-9-16-5-17-19(9)8(6)15-4-2-3-10(12,13)14/h5,15H,2-4H2,1H3 |
| InChIKey | UIDNEUAZUSETTJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.68 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|