C12H7BrClF2N5 — CID 103076997
N-(5-bromo-2,4-difluorophenyl)-5-chloro-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 103076997) has the molecular formula C12H7BrClF2N5 and a molecular weight of 374.58 g/mol. Its IUPAC name is N-(5-bromo-2,4-difluorophenyl)-5-chloro-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-(5-bromo-2,4-difluorophenyl)-5-chloro-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 103076997 |
| Molecular Formula | C12H7BrClF2N5 |
| Molecular Weight | 374.58 g/mol |
| Exact Mass | 372.95 |
| IUPAC Name | N-(5-bromo-2,4-difluorophenyl)-5-chloro-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1c(Cl)nc2ncnn2c1Nc1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C12H7BrClF2N5/c1-5-10(14)20-12-17-4-18-21(12)11(5)19-9-2-6(13)7(15)3-8(9)16/h2-4,19H,1H3 |
| InChIKey | VXOKKEPJKAJQRE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.58 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|