About 1-(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonyl-1,4-diazepan-5-one
1-(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonyl-1,4-diazepan-5-one (PubChem CID 103077470) has the molecular formula C11H12BrClFN3O3S
and a molecular weight of 400.66 g/mol. Its IUPAC name is 1-(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonyl-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 1-(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonyl-1,4-diazepan-5-one |
| PubChem CID | 103077470 |
| Molecular Formula | C11H12BrClFN3O3S |
| Molecular Weight | 400.66 g/mol |
| Exact Mass | 398.95 |
| IUPAC Name | 1-(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonyl-1,4-diazepan-5-one |
| SMILES | Nc1c(F)c(S(=O)(=O)N2CCNC(=O)CC2)cc(Cl)c1Br |
| InChI | InChI=1S/C11H12BrClFN3O3S/c12-9-6(13)5-7(10(14)11(9)15)21(19,20)17-3-1-8(18)16-2-4-17/h5H,1-4,15H2,(H,16,18) |
| InChIKey | JXBKEVKUKPTUJB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.66 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonyl-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonyl-1,4-diazepan-5-one?
The IUPAC name of 1-(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonyl-1,4-diazepan-5-one (CID 103077470) is 1-(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonyl-1,4-diazepan-5-one.
What is the SMILES notation for 1-(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonyl-1,4-diazepan-5-one?
The canonical SMILES for 1-(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonyl-1,4-diazepan-5-one is Nc1c(F)c(S(=O)(=O)N2CCNC(=O)CC2)cc(Cl)c1Br.
What is the InChIKey of 1-(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonyl-1,4-diazepan-5-one?
The InChIKey is JXBKEVKUKPTUJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12BrClFN3O3S/c12-9-6(13)5-7(10(14)11(9)15)21(19,20)17-3-1-8(18)16-2-4-17/h5H,1-4,15H2,(H,16,18).
What are the key properties of 1-(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonyl-1,4-diazepan-5-one?
1-(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonyl-1,4-diazepan-5-one has a molecular weight of 400.66 g/mol, XLogP of 1.33, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonyl-1,4-diazepan-5-one is sourced from PubChem (CID 103077470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).