About 3-N-[1-(3-chlorophenyl)ethyl]-3-N,1-dimethylpyrazole-3,4-diamine
3-N-[1-(3-chlorophenyl)ethyl]-3-N,1-dimethylpyrazole-3,4-diamine (PubChem CID 103078461) has the molecular formula C13H17ClN4
and a molecular weight of 264.76 g/mol. Its IUPAC name is 3-N-[1-(3-chlorophenyl)ethyl]-3-N,1-dimethylpyrazole-3,4-diamine.
Molecular Properties
| Compound Name | 3-N-[1-(3-chlorophenyl)ethyl]-3-N,1-dimethylpyrazole-3,4-diamine |
| PubChem CID | 103078461 |
| Molecular Formula | C13H17ClN4 |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 3-N-[1-(3-chlorophenyl)ethyl]-3-N,1-dimethylpyrazole-3,4-diamine |
| SMILES | CC(c1cccc(Cl)c1)N(C)c1nn(C)cc1N |
| InChI | InChI=1S/C13H17ClN4/c1-9(10-5-4-6-11(14)7-10)18(3)13-12(15)8-17(2)16-13/h4-9H,15H2,1-3H3 |
| InChIKey | ZQVXUPXFUUCXLH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-N-[1-(3-chlorophenyl)ethyl]-3-N,1-dimethylpyrazole-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-[1-(3-chlorophenyl)ethyl]-3-N,1-dimethylpyrazole-3,4-diamine?
The IUPAC name of 3-N-[1-(3-chlorophenyl)ethyl]-3-N,1-dimethylpyrazole-3,4-diamine (CID 103078461) is 3-N-[1-(3-chlorophenyl)ethyl]-3-N,1-dimethylpyrazole-3,4-diamine.
What is the SMILES notation for 3-N-[1-(3-chlorophenyl)ethyl]-3-N,1-dimethylpyrazole-3,4-diamine?
The canonical SMILES for 3-N-[1-(3-chlorophenyl)ethyl]-3-N,1-dimethylpyrazole-3,4-diamine is CC(c1cccc(Cl)c1)N(C)c1nn(C)cc1N.
What is the InChIKey of 3-N-[1-(3-chlorophenyl)ethyl]-3-N,1-dimethylpyrazole-3,4-diamine?
The InChIKey is ZQVXUPXFUUCXLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN4/c1-9(10-5-4-6-11(14)7-10)18(3)13-12(15)8-17(2)16-13/h4-9H,15H2,1-3H3.
What are the key properties of 3-N-[1-(3-chlorophenyl)ethyl]-3-N,1-dimethylpyrazole-3,4-diamine?
3-N-[1-(3-chlorophenyl)ethyl]-3-N,1-dimethylpyrazole-3,4-diamine has a molecular weight of 264.76 g/mol, XLogP of 2.85, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-[1-(3-chlorophenyl)ethyl]-3-N,1-dimethylpyrazole-3,4-diamine is sourced from PubChem (CID 103078461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).