About 2,3-dihydroxypropyl nitrite
2,3-dihydroxypropyl nitrite (PubChem CID 10307857) has the molecular formula C3H7NO4
and a molecular weight of 121.09 g/mol. Its IUPAC name is 2,3-dihydroxypropyl nitrite.
Molecular Properties
| Compound Name | 2,3-dihydroxypropyl nitrite |
| PubChem CID | 10307857 |
| Molecular Formula | C3H7NO4 |
| Molecular Weight | 121.09 g/mol |
| Exact Mass | 121.04 |
| IUPAC Name | 2,3-dihydroxypropyl nitrite |
| SMILES | O=NOCC(O)CO |
| InChI | InChI=1S/C3H7NO4/c5-1-3(6)2-8-4-7/h3,5-6H,1-2H2 |
| InChIKey | MZDZSGCOSYRIAQ-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.09 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydroxypropyl nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxypropyl nitrite?
The IUPAC name of 2,3-dihydroxypropyl nitrite (CID 10307857) is 2,3-dihydroxypropyl nitrite.
What is the SMILES notation for 2,3-dihydroxypropyl nitrite?
The canonical SMILES for 2,3-dihydroxypropyl nitrite is O=NOCC(O)CO.
What is the InChIKey of 2,3-dihydroxypropyl nitrite?
The InChIKey is MZDZSGCOSYRIAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO4/c5-1-3(6)2-8-4-7/h3,5-6H,1-2H2.
What are the key properties of 2,3-dihydroxypropyl nitrite?
2,3-dihydroxypropyl nitrite has a molecular weight of 121.09 g/mol, XLogP of -0.96, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxypropyl nitrite is sourced from PubChem (CID 10307857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).