C9H13N5O2 — CID 103078644
3-[(4-amino-1-methylpyrazol-3-yl)amino]-1-methylpyrrolidine-2,5-dione (PubChem CID 103078644) has the molecular formula C9H13N5O2 and a molecular weight of 223.24 g/mol. Its IUPAC name is 3-[(4-amino-1-methylpyrazol-3-yl)amino]-1-methylpyrrolidine-2,5-dione.
| Compound Name | 3-[(4-amino-1-methylpyrazol-3-yl)amino]-1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 103078644 |
| Molecular Formula | C9H13N5O2 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 3-[(4-amino-1-methylpyrazol-3-yl)amino]-1-methylpyrrolidine-2,5-dione |
| SMILES | CN1C(=O)CC(Nc2nn(C)cc2N)C1=O |
| InChI | InChI=1S/C9H13N5O2/c1-13-4-5(10)8(12-13)11-6-3-7(15)14(2)9(6)16/h4,6H,3,10H2,1-2H3,(H,11,12) |
| InChIKey | PBNHKBGCNANXIB-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|