C10H7F5N4 — CID 103078765
1-methyl-3-N-(2,3,4,5,6-pentafluorophenyl)pyrazole-3,4-diamine (PubChem CID 103078765) has the molecular formula C10H7F5N4 and a molecular weight of 278.18 g/mol. Its IUPAC name is 1-methyl-3-N-(2,3,4,5,6-pentafluorophenyl)pyrazole-3,4-diamine.
| Compound Name | 1-methyl-3-N-(2,3,4,5,6-pentafluorophenyl)pyrazole-3,4-diamine |
|---|---|
| PubChem CID | 103078765 |
| Molecular Formula | C10H7F5N4 |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 1-methyl-3-N-(2,3,4,5,6-pentafluorophenyl)pyrazole-3,4-diamine |
| SMILES | Cn1cc(N)c(Nc2c(F)c(F)c(F)c(F)c2F)n1 |
| InChI | InChI=1S/C10H7F5N4/c1-19-2-3(16)10(18-19)17-9-7(14)5(12)4(11)6(13)8(9)15/h2H,16H2,1H3,(H,17,18) |
| InChIKey | OTVOAFFZADLVLT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|