About N-(4-amino-1-methyl-2,6-dioxo-5H-pyrimidin-5-yl)acetamide
N-(4-amino-1-methyl-2,6-dioxo-5H-pyrimidin-5-yl)acetamide (PubChem CID 10307934) has the molecular formula C7H10N4O3
and a molecular weight of 198.18 g/mol. Its IUPAC name is N-(4-amino-1-methyl-2,6-dioxo-5H-pyrimidin-5-yl)acetamide.
Molecular Properties
| Compound Name | N-(4-amino-1-methyl-2,6-dioxo-5H-pyrimidin-5-yl)acetamide |
| PubChem CID | 10307934 |
| Molecular Formula | C7H10N4O3 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | N-(4-amino-1-methyl-2,6-dioxo-5H-pyrimidin-5-yl)acetamide |
| SMILES | CC(=O)NC1C(=O)N(C)C(=O)N=C1N |
| InChI | InChI=1S/C7H10N4O3/c1-3(12)9-4-5(8)10-7(14)11(2)6(4)13/h4H,1-2H3,(H,9,12)(H2,8,10,14) |
| InChIKey | LUMMTRCHDHANBK-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-amino-1-methyl-2,6-dioxo-5H-pyrimidin-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-amino-1-methyl-2,6-dioxo-5H-pyrimidin-5-yl)acetamide?
The IUPAC name of N-(4-amino-1-methyl-2,6-dioxo-5H-pyrimidin-5-yl)acetamide (CID 10307934) is N-(4-amino-1-methyl-2,6-dioxo-5H-pyrimidin-5-yl)acetamide.
What is the SMILES notation for N-(4-amino-1-methyl-2,6-dioxo-5H-pyrimidin-5-yl)acetamide?
The canonical SMILES for N-(4-amino-1-methyl-2,6-dioxo-5H-pyrimidin-5-yl)acetamide is CC(=O)NC1C(=O)N(C)C(=O)N=C1N.
What is the InChIKey of N-(4-amino-1-methyl-2,6-dioxo-5H-pyrimidin-5-yl)acetamide?
The InChIKey is LUMMTRCHDHANBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O3/c1-3(12)9-4-5(8)10-7(14)11(2)6(4)13/h4H,1-2H3,(H,9,12)(H2,8,10,14).
What are the key properties of N-(4-amino-1-methyl-2,6-dioxo-5H-pyrimidin-5-yl)acetamide?
N-(4-amino-1-methyl-2,6-dioxo-5H-pyrimidin-5-yl)acetamide has a molecular weight of 198.18 g/mol, XLogP of -1.56, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-amino-1-methyl-2,6-dioxo-5H-pyrimidin-5-yl)acetamide is sourced from PubChem (CID 10307934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).