About 2-(chloromethyl)-3,4-dihydrochromen-2-ol
2-(chloromethyl)-3,4-dihydrochromen-2-ol (PubChem CID 10307936) has the molecular formula C10H11ClO2
and a molecular weight of 198.65 g/mol. Its IUPAC name is 2-(chloromethyl)-3,4-dihydrochromen-2-ol.
Molecular Properties
| Compound Name | 2-(chloromethyl)-3,4-dihydrochromen-2-ol |
| PubChem CID | 10307936 |
| Molecular Formula | C10H11ClO2 |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 2-(chloromethyl)-3,4-dihydrochromen-2-ol |
| SMILES | OC1(CCl)CCc2ccccc2O1 |
| InChI | InChI=1S/C10H11ClO2/c11-7-10(12)6-5-8-3-1-2-4-9(8)13-10/h1-4,12H,5-7H2 |
| InChIKey | ZWEFDDRDBSAKNT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-3,4-dihydrochromen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-3,4-dihydrochromen-2-ol?
The IUPAC name of 2-(chloromethyl)-3,4-dihydrochromen-2-ol (CID 10307936) is 2-(chloromethyl)-3,4-dihydrochromen-2-ol.
What is the SMILES notation for 2-(chloromethyl)-3,4-dihydrochromen-2-ol?
The canonical SMILES for 2-(chloromethyl)-3,4-dihydrochromen-2-ol is OC1(CCl)CCc2ccccc2O1.
What is the InChIKey of 2-(chloromethyl)-3,4-dihydrochromen-2-ol?
The InChIKey is ZWEFDDRDBSAKNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO2/c11-7-10(12)6-5-8-3-1-2-4-9(8)13-10/h1-4,12H,5-7H2.
What are the key properties of 2-(chloromethyl)-3,4-dihydrochromen-2-ol?
2-(chloromethyl)-3,4-dihydrochromen-2-ol has a molecular weight of 198.65 g/mol, XLogP of 1.94, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-3,4-dihydrochromen-2-ol is sourced from PubChem (CID 10307936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).