C10H9Cl2N3S — CID 103079526
3-(2,5-dichlorophenyl)sulfanyl-1-methylpyrazol-4-amine (PubChem CID 103079526) has the molecular formula C10H9Cl2N3S and a molecular weight of 274.18 g/mol. Its IUPAC name is 3-(2,5-dichlorophenyl)sulfanyl-1-methylpyrazol-4-amine.
| Compound Name | 3-(2,5-dichlorophenyl)sulfanyl-1-methylpyrazol-4-amine |
|---|---|
| PubChem CID | 103079526 |
| Molecular Formula | C10H9Cl2N3S |
| Molecular Weight | 274.18 g/mol |
| Exact Mass | 272.99 |
| IUPAC Name | 3-(2,5-dichlorophenyl)sulfanyl-1-methylpyrazol-4-amine |
| SMILES | Cn1cc(N)c(Sc2cc(Cl)ccc2Cl)n1 |
| InChI | InChI=1S/C10H9Cl2N3S/c1-15-5-8(13)10(14-15)16-9-4-6(11)2-3-7(9)12/h2-5H,13H2,1H3 |
| InChIKey | JHTPFYQTEIZOQJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.18 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |