About 1-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)pyrazol-4-amine
1-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)pyrazol-4-amine (PubChem CID 103079624) has the molecular formula C6H7N5S2
and a molecular weight of 213.29 g/mol. Its IUPAC name is 1-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)pyrazol-4-amine.
Molecular Properties
| Compound Name | 1-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)pyrazol-4-amine |
| PubChem CID | 103079624 |
| Molecular Formula | C6H7N5S2 |
| Molecular Weight | 213.29 g/mol |
| Exact Mass | 213.01 |
| IUPAC Name | 1-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)pyrazol-4-amine |
| SMILES | Cn1cc(N)c(Sc2ncns2)n1 |
| InChI | InChI=1S/C6H7N5S2/c1-11-2-4(7)5(10-11)12-6-8-3-9-13-6/h2-3H,7H2,1H3 |
| InChIKey | ZDCKLFCOKCRXBR-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)pyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)pyrazol-4-amine?
The IUPAC name of 1-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)pyrazol-4-amine (CID 103079624) is 1-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)pyrazol-4-amine.
What is the SMILES notation for 1-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)pyrazol-4-amine?
The canonical SMILES for 1-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)pyrazol-4-amine is Cn1cc(N)c(Sc2ncns2)n1.
What is the InChIKey of 1-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)pyrazol-4-amine?
The InChIKey is ZDCKLFCOKCRXBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5S2/c1-11-2-4(7)5(10-11)12-6-8-3-9-13-6/h2-3H,7H2,1H3.
What are the key properties of 1-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)pyrazol-4-amine?
1-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)pyrazol-4-amine has a molecular weight of 213.29 g/mol, XLogP of 1.00, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(1,2,4-thiadiazol-5-ylsulfanyl)pyrazol-4-amine is sourced from PubChem (CID 103079624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).