C13H15N5O2 — CID 103080240
1-(1-methyl-4-nitropyrazol-3-yl)-2,3,4,5-tetrahydro-1,4-benzodiazepine (PubChem CID 103080240) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is 1-(1-methyl-4-nitropyrazol-3-yl)-2,3,4,5-tetrahydro-1,4-benzodiazepine.
| Compound Name | 1-(1-methyl-4-nitropyrazol-3-yl)-2,3,4,5-tetrahydro-1,4-benzodiazepine |
|---|---|
| PubChem CID | 103080240 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 1-(1-methyl-4-nitropyrazol-3-yl)-2,3,4,5-tetrahydro-1,4-benzodiazepine |
| SMILES | Cn1cc([N+](=O)[O-])c(N2CCNCc3ccccc32)n1 |
| InChI | InChI=1S/C13H15N5O2/c1-16-9-12(18(19)20)13(15-16)17-7-6-14-8-10-4-2-3-5-11(10)17/h2-5,9,14H,6-8H2,1H3 |
| InChIKey | UREORLPZLDKOPS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|