About 2-[2-(2,2-difluoroethoxy)ethylamino]-N-prop-2-enylpropanamide
2-[2-(2,2-difluoroethoxy)ethylamino]-N-prop-2-enylpropanamide (PubChem CID 103080635) has the molecular formula C10H18F2N2O2
and a molecular weight of 236.26 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethylamino]-N-prop-2-enylpropanamide.
Molecular Properties
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethylamino]-N-prop-2-enylpropanamide |
| PubChem CID | 103080635 |
| Molecular Formula | C10H18F2N2O2 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethylamino]-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(C)NCCOCC(F)F |
| InChI | InChI=1S/C10H18F2N2O2/c1-3-4-14-10(15)8(2)13-5-6-16-7-9(11)12/h3,8-9,13H,1,4-7H2,2H3,(H,14,15) |
| InChIKey | CORBMXAFMGEEMB-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,2-difluoroethoxy)ethylamino]-N-prop-2-enylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,2-difluoroethoxy)ethylamino]-N-prop-2-enylpropanamide?
The IUPAC name of 2-[2-(2,2-difluoroethoxy)ethylamino]-N-prop-2-enylpropanamide (CID 103080635) is 2-[2-(2,2-difluoroethoxy)ethylamino]-N-prop-2-enylpropanamide.
What is the SMILES notation for 2-[2-(2,2-difluoroethoxy)ethylamino]-N-prop-2-enylpropanamide?
The canonical SMILES for 2-[2-(2,2-difluoroethoxy)ethylamino]-N-prop-2-enylpropanamide is C=CCNC(=O)C(C)NCCOCC(F)F.
What is the InChIKey of 2-[2-(2,2-difluoroethoxy)ethylamino]-N-prop-2-enylpropanamide?
The InChIKey is CORBMXAFMGEEMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F2N2O2/c1-3-4-14-10(15)8(2)13-5-6-16-7-9(11)12/h3,8-9,13H,1,4-7H2,2H3,(H,14,15).
What are the key properties of 2-[2-(2,2-difluoroethoxy)ethylamino]-N-prop-2-enylpropanamide?
2-[2-(2,2-difluoroethoxy)ethylamino]-N-prop-2-enylpropanamide has a molecular weight of 236.26 g/mol, XLogP of 0.55, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,2-difluoroethoxy)ethylamino]-N-prop-2-enylpropanamide is sourced from PubChem (CID 103080635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).