C12H23F2NO2 — CID 103080941
N-[2-(2,2-difluoroethoxy)ethyl]-2-propyloxan-4-amine (PubChem CID 103080941) has the molecular formula C12H23F2NO2 and a molecular weight of 251.32 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-2-propyloxan-4-amine.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-2-propyloxan-4-amine |
|---|---|
| PubChem CID | 103080941 |
| Molecular Formula | C12H23F2NO2 |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-2-propyloxan-4-amine |
| SMILES | CCCC1CC(NCCOCC(F)F)CCO1 |
| InChI | InChI=1S/C12H23F2NO2/c1-2-3-11-8-10(4-6-17-11)15-5-7-16-9-12(13)14/h10-12,15H,2-9H2,1H3 |
| InChIKey | SYFJNYPKRMGEKG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|