C12H16F2N4O — CID 103080968
2-(2,2-difluoroethoxy)-N-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methyl]ethanamine (PubChem CID 103080968) has the molecular formula C12H16F2N4O and a molecular weight of 270.28 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-N-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methyl]ethanamine.
| Compound Name | 2-(2,2-difluoroethoxy)-N-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 103080968 |
| Molecular Formula | C12H16F2N4O |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-N-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methyl]ethanamine |
| SMILES | Cc1cc2ncc(CNCCOCC(F)F)cn2n1 |
| InChI | InChI=1S/C12H16F2N4O/c1-9-4-12-16-6-10(7-18(12)17-9)5-15-2-3-19-8-11(13)14/h4,6-7,11,15H,2-3,5,8H2,1H3 |
| InChIKey | YGUSCSVFQRAJLC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|