About 2-(2,2-difluoroethoxy)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]ethanamine
2-(2,2-difluoroethoxy)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]ethanamine (PubChem CID 103081053) has the molecular formula C10H17F2N3O
and a molecular weight of 233.26 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]ethanamine.
Molecular Properties
| Compound Name | 2-(2,2-difluoroethoxy)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]ethanamine |
| PubChem CID | 103081053 |
| Molecular Formula | C10H17F2N3O |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]ethanamine |
| SMILES | Cc1n[nH]c(C)c1CNCCOCC(F)F |
| InChI | InChI=1S/C10H17F2N3O/c1-7-9(8(2)15-14-7)5-13-3-4-16-6-10(11)12/h10,13H,3-6H2,1-2H3,(H,14,15) |
| InChIKey | QRENDCDJRSBSAB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-difluoroethoxy)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-difluoroethoxy)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]ethanamine?
The IUPAC name of 2-(2,2-difluoroethoxy)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]ethanamine (CID 103081053) is 2-(2,2-difluoroethoxy)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]ethanamine.
What is the SMILES notation for 2-(2,2-difluoroethoxy)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]ethanamine?
The canonical SMILES for 2-(2,2-difluoroethoxy)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]ethanamine is Cc1n[nH]c(C)c1CNCCOCC(F)F.
What is the InChIKey of 2-(2,2-difluoroethoxy)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]ethanamine?
The InChIKey is QRENDCDJRSBSAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2N3O/c1-7-9(8(2)15-14-7)5-13-3-4-16-6-10(11)12/h10,13H,3-6H2,1-2H3,(H,14,15).
What are the key properties of 2-(2,2-difluoroethoxy)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]ethanamine?
2-(2,2-difluoroethoxy)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]ethanamine has a molecular weight of 233.26 g/mol, XLogP of 1.40, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoroethoxy)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]ethanamine is sourced from PubChem (CID 103081053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).