About 2-(2,2-difluoroethoxy)-N-(1,3-thiazol-4-ylmethyl)ethanamine
2-(2,2-difluoroethoxy)-N-(1,3-thiazol-4-ylmethyl)ethanamine (PubChem CID 103081055) has the molecular formula C8H12F2N2OS
and a molecular weight of 222.26 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-N-(1,3-thiazol-4-ylmethyl)ethanamine.
Molecular Properties
| Compound Name | 2-(2,2-difluoroethoxy)-N-(1,3-thiazol-4-ylmethyl)ethanamine |
| PubChem CID | 103081055 |
| Molecular Formula | C8H12F2N2OS |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-N-(1,3-thiazol-4-ylmethyl)ethanamine |
| SMILES | FC(F)COCCNCc1cscn1 |
| InChI | InChI=1S/C8H12F2N2OS/c9-8(10)4-13-2-1-11-3-7-5-14-6-12-7/h5-6,8,11H,1-4H2 |
| InChIKey | IBCUSRTVOTZJJM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-difluoroethoxy)-N-(1,3-thiazol-4-ylmethyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-difluoroethoxy)-N-(1,3-thiazol-4-ylmethyl)ethanamine?
The IUPAC name of 2-(2,2-difluoroethoxy)-N-(1,3-thiazol-4-ylmethyl)ethanamine (CID 103081055) is 2-(2,2-difluoroethoxy)-N-(1,3-thiazol-4-ylmethyl)ethanamine.
What is the SMILES notation for 2-(2,2-difluoroethoxy)-N-(1,3-thiazol-4-ylmethyl)ethanamine?
The canonical SMILES for 2-(2,2-difluoroethoxy)-N-(1,3-thiazol-4-ylmethyl)ethanamine is FC(F)COCCNCc1cscn1.
What is the InChIKey of 2-(2,2-difluoroethoxy)-N-(1,3-thiazol-4-ylmethyl)ethanamine?
The InChIKey is IBCUSRTVOTZJJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2N2OS/c9-8(10)4-13-2-1-11-3-7-5-14-6-12-7/h5-6,8,11H,1-4H2.
What are the key properties of 2-(2,2-difluoroethoxy)-N-(1,3-thiazol-4-ylmethyl)ethanamine?
2-(2,2-difluoroethoxy)-N-(1,3-thiazol-4-ylmethyl)ethanamine has a molecular weight of 222.26 g/mol, XLogP of 1.51, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoroethoxy)-N-(1,3-thiazol-4-ylmethyl)ethanamine is sourced from PubChem (CID 103081055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).