C15H21F2NO3 — CID 103081100
2-(2,2-difluoroethoxy)-N-[(5-methoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]ethanamine (PubChem CID 103081100) has the molecular formula C15H21F2NO3 and a molecular weight of 301.33 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-N-[(5-methoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]ethanamine.
| Compound Name | 2-(2,2-difluoroethoxy)-N-[(5-methoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 103081100 |
| Molecular Formula | C15H21F2NO3 |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-N-[(5-methoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]ethanamine |
| SMILES | COc1cc2c(cc1CNCCOCC(F)F)OC(C)C2 |
| InChI | InChI=1S/C15H21F2NO3/c1-10-5-11-6-13(19-2)12(7-14(11)21-10)8-18-3-4-20-9-15(16)17/h6-7,10,15,18H,3-5,8-9H2,1-2H3 |
| InChIKey | WGGZPDXAWJQWLS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|