C16H28F2N2O3 — CID 103081167
tert-butyl 3-[2-(2,2-difluoroethoxy)ethylamino]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 103081167) has the molecular formula C16H28F2N2O3 and a molecular weight of 334.41 g/mol. Its IUPAC name is tert-butyl 3-[2-(2,2-difluoroethoxy)ethylamino]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[2-(2,2-difluoroethoxy)ethylamino]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 103081167 |
| Molecular Formula | C16H28F2N2O3 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | tert-butyl 3-[2-(2,2-difluoroethoxy)ethylamino]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CC(NCCOCC(F)F)C2 |
| InChI | InChI=1S/C16H28F2N2O3/c1-16(2,3)23-15(21)20-12-4-5-13(20)9-11(8-12)19-6-7-22-10-14(17)18/h11-14,19H,4-10H2,1-3H3 |
| InChIKey | AEAPAAATBRFASA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|