C10H16F2N2OS — CID 103081191
2-(2,2-difluoroethoxy)-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]ethanamine (PubChem CID 103081191) has the molecular formula C10H16F2N2OS and a molecular weight of 250.31 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]ethanamine.
| Compound Name | 2-(2,2-difluoroethoxy)-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 103081191 |
| Molecular Formula | C10H16F2N2OS |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]ethanamine |
| SMILES | Cc1nc(C)c(CNCCOCC(F)F)s1 |
| InChI | InChI=1S/C10H16F2N2OS/c1-7-9(16-8(2)14-7)5-13-3-4-15-6-10(11)12/h10,13H,3-6H2,1-2H3 |
| InChIKey | MBRFAZQJUAOGGJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|