C11H15F2N3OS — CID 103081246
2-(2,2-difluoroethoxy)-N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]ethanamine (PubChem CID 103081246) has the molecular formula C11H15F2N3OS and a molecular weight of 275.32 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]ethanamine.
| Compound Name | 2-(2,2-difluoroethoxy)-N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 103081246 |
| Molecular Formula | C11H15F2N3OS |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]ethanamine |
| SMILES | Cc1nc2sccn2c1CNCCOCC(F)F |
| InChI | InChI=1S/C11H15F2N3OS/c1-8-9(16-3-5-18-11(16)15-8)6-14-2-4-17-7-10(12)13/h3,5,10,14H,2,4,6-7H2,1H3 |
| InChIKey | SPPOGRVBAXDFBL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|