C8H12F2N2OS — CID 103081253
2-(2,2-difluoroethoxy)-N-(1,3-thiazol-5-ylmethyl)ethanamine (PubChem CID 103081253) has the molecular formula C8H12F2N2OS and a molecular weight of 222.26 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-N-(1,3-thiazol-5-ylmethyl)ethanamine.
| Compound Name | 2-(2,2-difluoroethoxy)-N-(1,3-thiazol-5-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 103081253 |
| Molecular Formula | C8H12F2N2OS |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-N-(1,3-thiazol-5-ylmethyl)ethanamine |
| SMILES | FC(F)COCCNCc1cncs1 |
| InChI | InChI=1S/C8H12F2N2OS/c9-8(10)5-13-2-1-11-3-7-4-12-6-14-7/h4,6,8,11H,1-3,5H2 |
| InChIKey | XUIPHGMKEGRSRH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|