C12H17F2N3OS — CID 103081264
2-(2,2-difluoroethoxy)-N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]ethanamine (PubChem CID 103081264) has the molecular formula C12H17F2N3OS and a molecular weight of 289.35 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]ethanamine.
| Compound Name | 2-(2,2-difluoroethoxy)-N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 103081264 |
| Molecular Formula | C12H17F2N3OS |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]ethanamine |
| SMILES | Cc1cn2c(CNCCOCC(F)F)c(C)nc2s1 |
| InChI | InChI=1S/C12H17F2N3OS/c1-8-6-17-10(9(2)16-12(17)19-8)5-15-3-4-18-7-11(13)14/h6,11,15H,3-5,7H2,1-2H3 |
| InChIKey | MNHZWILVLOOBMJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|