C9H11F2N5O — CID 103081314
N-[2-(2,2-difluoroethoxy)ethyl]-[1,2,4]triazolo[4,3-a]pyrazin-8-amine (PubChem CID 103081314) has the molecular formula C9H11F2N5O and a molecular weight of 243.22 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-[1,2,4]triazolo[4,3-a]pyrazin-8-amine.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 103081314 |
| Molecular Formula | C9H11F2N5O |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
| SMILES | FC(F)COCCNc1nccn2cnnc12 |
| InChI | InChI=1S/C9H11F2N5O/c10-7(11)5-17-4-2-13-8-9-15-14-6-16(9)3-1-12-8/h1,3,6-7H,2,4-5H2,(H,12,13) |
| InChIKey | RFAZAGMRTGICLZ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|