C9H10F2N4O3S — CID 103081320
N-[2-(2,2-difluoroethoxy)ethyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 103081320) has the molecular formula C9H10F2N4O3S and a molecular weight of 292.27 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 103081320 |
| Molecular Formula | C9H10F2N4O3S |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | O=[N+]([O-])c1c(NCCOCC(F)F)nc2sccn12 |
| InChI | InChI=1S/C9H10F2N4O3S/c10-6(11)5-18-3-1-12-7-8(15(16)17)14-2-4-19-9(14)13-7/h2,4,6,12H,1,3,5H2 |
| InChIKey | YYAHQRQENPWXND-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|