C9H11F2N5O2 — CID 103081336
6-[2-(2,2-difluoroethoxy)ethylamino]-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one (PubChem CID 103081336) has the molecular formula C9H11F2N5O2 and a molecular weight of 259.22 g/mol. Its IUPAC name is 6-[2-(2,2-difluoroethoxy)ethylamino]-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one.
| Compound Name | 6-[2-(2,2-difluoroethoxy)ethylamino]-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
|---|---|
| PubChem CID | 103081336 |
| Molecular Formula | C9H11F2N5O2 |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 6-[2-(2,2-difluoroethoxy)ethylamino]-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
| SMILES | O=c1[nH]nc2ccc(NCCOCC(F)F)nn12 |
| InChI | InChI=1S/C9H11F2N5O2/c10-6(11)5-18-4-3-12-7-1-2-8-13-14-9(17)16(8)15-7/h1-2,6H,3-5H2,(H,12,15)(H,14,17) |
| InChIKey | WHIBTBARRQEYMU-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|