About 3-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-5-nitropyridin-2-amine
3-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-5-nitropyridin-2-amine (PubChem CID 103081343) has the molecular formula C10H12BrF2N3O3
and a molecular weight of 340.12 g/mol. Its IUPAC name is 3-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-5-nitropyridin-2-amine.
Molecular Properties
| Compound Name | 3-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-5-nitropyridin-2-amine |
| PubChem CID | 103081343 |
| Molecular Formula | C10H12BrF2N3O3 |
| Molecular Weight | 340.12 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | 3-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-5-nitropyridin-2-amine |
| SMILES | Cc1c([N+](=O)[O-])cnc(NCCOCC(F)F)c1Br |
| InChI | InChI=1S/C10H12BrF2N3O3/c1-6-7(16(17)18)4-15-10(9(6)11)14-2-3-19-5-8(12)13/h4,8H,2-3,5H2,1H3,(H,14,15) |
| InChIKey | WGKNPWCJPZVRTR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.12 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-5-nitropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-5-nitropyridin-2-amine?
The IUPAC name of 3-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-5-nitropyridin-2-amine (CID 103081343) is 3-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-5-nitropyridin-2-amine.
What is the SMILES notation for 3-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-5-nitropyridin-2-amine?
The canonical SMILES for 3-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-5-nitropyridin-2-amine is Cc1c([N+](=O)[O-])cnc(NCCOCC(F)F)c1Br.
What is the InChIKey of 3-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-5-nitropyridin-2-amine?
The InChIKey is WGKNPWCJPZVRTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrF2N3O3/c1-6-7(16(17)18)4-15-10(9(6)11)14-2-3-19-5-8(12)13/h4,8H,2-3,5H2,1H3,(H,14,15).
What are the key properties of 3-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-5-nitropyridin-2-amine?
3-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-5-nitropyridin-2-amine has a molecular weight of 340.12 g/mol, XLogP of 2.75, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-5-nitropyridin-2-amine is sourced from PubChem (CID 103081343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).