C10H13F2N5O — CID 103081515
N-[2-(2,2-difluoroethoxy)ethyl]-3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine (PubChem CID 103081515) has the molecular formula C10H13F2N5O and a molecular weight of 257.24 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 103081515 |
| Molecular Formula | C10H13F2N5O |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
| SMILES | Cc1nnc2c(NCCOCC(F)F)nccn12 |
| InChI | InChI=1S/C10H13F2N5O/c1-7-15-16-10-9(13-2-4-17(7)10)14-3-5-18-6-8(11)12/h2,4,8H,3,5-6H2,1H3,(H,13,14) |
| InChIKey | ASNPOVHYRRMEQR-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|