About 6-chloro-N-[2-(2,2-difluoroethoxy)ethyl]-2-ethyl-5-methylpyrimidin-4-amine
6-chloro-N-[2-(2,2-difluoroethoxy)ethyl]-2-ethyl-5-methylpyrimidin-4-amine (PubChem CID 103081587) has the molecular formula C11H16ClF2N3O
and a molecular weight of 279.72 g/mol. Its IUPAC name is 6-chloro-N-[2-(2,2-difluoroethoxy)ethyl]-2-ethyl-5-methylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-chloro-N-[2-(2,2-difluoroethoxy)ethyl]-2-ethyl-5-methylpyrimidin-4-amine |
| PubChem CID | 103081587 |
| Molecular Formula | C11H16ClF2N3O |
| Molecular Weight | 279.72 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 6-chloro-N-[2-(2,2-difluoroethoxy)ethyl]-2-ethyl-5-methylpyrimidin-4-amine |
| SMILES | CCc1nc(Cl)c(C)c(NCCOCC(F)F)n1 |
| InChI | InChI=1S/C11H16ClF2N3O/c1-3-9-16-10(12)7(2)11(17-9)15-4-5-18-6-8(13)14/h8H,3-6H2,1-2H3,(H,15,16,17) |
| InChIKey | MIYBXGQWDGKJDX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.72 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-N-[2-(2,2-difluoroethoxy)ethyl]-2-ethyl-5-methylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-[2-(2,2-difluoroethoxy)ethyl]-2-ethyl-5-methylpyrimidin-4-amine?
The IUPAC name of 6-chloro-N-[2-(2,2-difluoroethoxy)ethyl]-2-ethyl-5-methylpyrimidin-4-amine (CID 103081587) is 6-chloro-N-[2-(2,2-difluoroethoxy)ethyl]-2-ethyl-5-methylpyrimidin-4-amine.
What is the SMILES notation for 6-chloro-N-[2-(2,2-difluoroethoxy)ethyl]-2-ethyl-5-methylpyrimidin-4-amine?
The canonical SMILES for 6-chloro-N-[2-(2,2-difluoroethoxy)ethyl]-2-ethyl-5-methylpyrimidin-4-amine is CCc1nc(Cl)c(C)c(NCCOCC(F)F)n1.
What is the InChIKey of 6-chloro-N-[2-(2,2-difluoroethoxy)ethyl]-2-ethyl-5-methylpyrimidin-4-amine?
The InChIKey is MIYBXGQWDGKJDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16ClF2N3O/c1-3-9-16-10(12)7(2)11(17-9)15-4-5-18-6-8(13)14/h8H,3-6H2,1-2H3,(H,15,16,17).
What are the key properties of 6-chloro-N-[2-(2,2-difluoroethoxy)ethyl]-2-ethyl-5-methylpyrimidin-4-amine?
6-chloro-N-[2-(2,2-difluoroethoxy)ethyl]-2-ethyl-5-methylpyrimidin-4-amine has a molecular weight of 279.72 g/mol, XLogP of 2.69, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-[2-(2,2-difluoroethoxy)ethyl]-2-ethyl-5-methylpyrimidin-4-amine is sourced from PubChem (CID 103081587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).