C11H11ClF2N2O3S — CID 103081892
3-chloro-4-cyano-N-[2-(2,2-difluoroethoxy)ethyl]benzenesulfonamide (PubChem CID 103081892) has the molecular formula C11H11ClF2N2O3S and a molecular weight of 324.74 g/mol. Its IUPAC name is 3-chloro-4-cyano-N-[2-(2,2-difluoroethoxy)ethyl]benzenesulfonamide.
| Compound Name | 3-chloro-4-cyano-N-[2-(2,2-difluoroethoxy)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 103081892 |
| Molecular Formula | C11H11ClF2N2O3S |
| Molecular Weight | 324.74 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 3-chloro-4-cyano-N-[2-(2,2-difluoroethoxy)ethyl]benzenesulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NCCOCC(F)F)cc1Cl |
| InChI | InChI=1S/C11H11ClF2N2O3S/c12-10-5-9(2-1-8(10)6-15)20(17,18)16-3-4-19-7-11(13)14/h1-2,5,11,16H,3-4,7H2 |
| InChIKey | DJBXIXBCFKJUPI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.74 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|