About N-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrazole-4-sulfonamide
N-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrazole-4-sulfonamide (PubChem CID 103081931) has the molecular formula C7H11F2N3O3S
and a molecular weight of 255.25 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrazole-4-sulfonamide |
| PubChem CID | 103081931 |
| Molecular Formula | C7H11F2N3O3S |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrazole-4-sulfonamide |
| SMILES | O=S(=O)(NCCOCC(F)F)c1cn[nH]c1 |
| InChI | InChI=1S/C7H11F2N3O3S/c8-7(9)5-15-2-1-12-16(13,14)6-3-10-11-4-6/h3-4,7,12H,1-2,5H2,(H,10,11) |
| InChIKey | JLABNIABGYHFGH-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrazole-4-sulfonamide?
The IUPAC name of N-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrazole-4-sulfonamide (CID 103081931) is N-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrazole-4-sulfonamide.
What is the SMILES notation for N-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrazole-4-sulfonamide?
The canonical SMILES for N-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrazole-4-sulfonamide is O=S(=O)(NCCOCC(F)F)c1cn[nH]c1.
What is the InChIKey of N-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrazole-4-sulfonamide?
The InChIKey is JLABNIABGYHFGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F2N3O3S/c8-7(9)5-15-2-1-12-16(13,14)6-3-10-11-4-6/h3-4,7,12H,1-2,5H2,(H,10,11).
What are the key properties of N-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrazole-4-sulfonamide?
N-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrazole-4-sulfonamide has a molecular weight of 255.25 g/mol, XLogP of -0.03, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrazole-4-sulfonamide is sourced from PubChem (CID 103081931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).