C10H19F2NO2 — CID 103082597
3-[2-(2,2-difluoroethoxy)ethylamino]-2,2-dimethylcyclobutan-1-ol (PubChem CID 103082597) has the molecular formula C10H19F2NO2 and a molecular weight of 223.26 g/mol. Its IUPAC name is 3-[2-(2,2-difluoroethoxy)ethylamino]-2,2-dimethylcyclobutan-1-ol.
| Compound Name | 3-[2-(2,2-difluoroethoxy)ethylamino]-2,2-dimethylcyclobutan-1-ol |
|---|---|
| PubChem CID | 103082597 |
| Molecular Formula | C10H19F2NO2 |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 3-[2-(2,2-difluoroethoxy)ethylamino]-2,2-dimethylcyclobutan-1-ol |
| SMILES | CC1(C)C(O)CC1NCCOCC(F)F |
| InChI | InChI=1S/C10H19F2NO2/c1-10(2)7(5-8(10)14)13-3-4-15-6-9(11)12/h7-9,13-14H,3-6H2,1-2H3 |
| InChIKey | QAEOFPANUWCSKM-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|