About N-[2-(2,2-difluoroethoxy)ethyl]thiolan-3-amine
N-[2-(2,2-difluoroethoxy)ethyl]thiolan-3-amine (PubChem CID 103082627) has the molecular formula C8H15F2NOS
and a molecular weight of 211.28 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]thiolan-3-amine.
Molecular Properties
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]thiolan-3-amine |
| PubChem CID | 103082627 |
| Molecular Formula | C8H15F2NOS |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]thiolan-3-amine |
| SMILES | FC(F)COCCNC1CCSC1 |
| InChI | InChI=1S/C8H15F2NOS/c9-8(10)5-12-3-2-11-7-1-4-13-6-7/h7-8,11H,1-6H2 |
| InChIKey | FNCYJUJUEOAHES-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2,2-difluoroethoxy)ethyl]thiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,2-difluoroethoxy)ethyl]thiolan-3-amine?
The IUPAC name of N-[2-(2,2-difluoroethoxy)ethyl]thiolan-3-amine (CID 103082627) is N-[2-(2,2-difluoroethoxy)ethyl]thiolan-3-amine.
What is the SMILES notation for N-[2-(2,2-difluoroethoxy)ethyl]thiolan-3-amine?
The canonical SMILES for N-[2-(2,2-difluoroethoxy)ethyl]thiolan-3-amine is FC(F)COCCNC1CCSC1.
What is the InChIKey of N-[2-(2,2-difluoroethoxy)ethyl]thiolan-3-amine?
The InChIKey is FNCYJUJUEOAHES-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F2NOS/c9-8(10)5-12-3-2-11-7-1-4-13-6-7/h7-8,11H,1-6H2.
What are the key properties of N-[2-(2,2-difluoroethoxy)ethyl]thiolan-3-amine?
N-[2-(2,2-difluoroethoxy)ethyl]thiolan-3-amine has a molecular weight of 211.28 g/mol, XLogP of 1.36, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,2-difluoroethoxy)ethyl]thiolan-3-amine is sourced from PubChem (CID 103082627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).