C10H19F2NO3S — CID 103082634
N-[2-(2,2-difluoroethoxy)ethyl]-2-methylsulfonylcyclopentan-1-amine (PubChem CID 103082634) has the molecular formula C10H19F2NO3S and a molecular weight of 271.33 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-2-methylsulfonylcyclopentan-1-amine.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-2-methylsulfonylcyclopentan-1-amine |
|---|---|
| PubChem CID | 103082634 |
| Molecular Formula | C10H19F2NO3S |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-2-methylsulfonylcyclopentan-1-amine |
| SMILES | CS(=O)(=O)C1CCCC1NCCOCC(F)F |
| InChI | InChI=1S/C10H19F2NO3S/c1-17(14,15)9-4-2-3-8(9)13-5-6-16-7-10(11)12/h8-10,13H,2-7H2,1H3 |
| InChIKey | GVMVVQBHTRFBJO-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|