C13H18BrF2NO — CID 103082647
1-(3-bromophenyl)-N-[2-(2,2-difluoroethoxy)ethyl]propan-1-amine (PubChem CID 103082647) has the molecular formula C13H18BrF2NO and a molecular weight of 322.19 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-[2-(2,2-difluoroethoxy)ethyl]propan-1-amine.
| Compound Name | 1-(3-bromophenyl)-N-[2-(2,2-difluoroethoxy)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 103082647 |
| Molecular Formula | C13H18BrF2NO |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 1-(3-bromophenyl)-N-[2-(2,2-difluoroethoxy)ethyl]propan-1-amine |
| SMILES | CCC(NCCOCC(F)F)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H18BrF2NO/c1-2-12(10-4-3-5-11(14)8-10)17-6-7-18-9-13(15)16/h3-5,8,12-13,17H,2,6-7,9H2,1H3 |
| InChIKey | BGJOSPAGIIQLCK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|