C10H18F5NO — CID 103082676
N-[2-(2,2-difluoroethoxy)ethyl]-6,6,6-trifluorohexan-2-amine (PubChem CID 103082676) has the molecular formula C10H18F5NO and a molecular weight of 263.25 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-6,6,6-trifluorohexan-2-amine.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-6,6,6-trifluorohexan-2-amine |
|---|---|
| PubChem CID | 103082676 |
| Molecular Formula | C10H18F5NO |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-6,6,6-trifluorohexan-2-amine |
| SMILES | CC(CCCC(F)(F)F)NCCOCC(F)F |
| InChI | InChI=1S/C10H18F5NO/c1-8(3-2-4-10(13,14)15)16-5-6-17-7-9(11)12/h8-9,16H,2-7H2,1H3 |
| InChIKey | AWTLLVYDEOLXTH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|