C16H16N2O3 — CID 10308292
4-(hydroxymethyl)-6-methyl-3a,4,5,10c-tetrahydropyrrolo[3,4-c]carbazole-1,3-dione (PubChem CID 10308292) has the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. Its IUPAC name is 4-(hydroxymethyl)-6-methyl-3a,4,5,10c-tetrahydropyrrolo[3,4-c]carbazole-1,3-dione.
| Compound Name | 4-(hydroxymethyl)-6-methyl-3a,4,5,10c-tetrahydropyrrolo[3,4-c]carbazole-1,3-dione |
|---|---|
| PubChem CID | 10308292 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 4-(hydroxymethyl)-6-methyl-3a,4,5,10c-tetrahydropyrrolo[3,4-c]carbazole-1,3-dione |
| SMILES | Cn1c2c(c3ccccc31)C1C(=O)NC(=O)C1C(CO)C2 |
| InChI | InChI=1S/C16H16N2O3/c1-18-10-5-3-2-4-9(10)13-11(18)6-8(7-19)12-14(13)16(21)17-15(12)20/h2-5,8,12,14,19H,6-7H2,1H3,(H,17,20,21) |
| InChIKey | YUTQFNLCBOQYJF-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|