About methyl 2-[5-[[2-(2,2-difluoroethoxy)ethylamino]methyl]thiophen-2-yl]acetate
methyl 2-[5-[[2-(2,2-difluoroethoxy)ethylamino]methyl]thiophen-2-yl]acetate (PubChem CID 103083079) has the molecular formula C12H17F2NO3S
and a molecular weight of 293.33 g/mol. Its IUPAC name is methyl 2-[5-[[2-(2,2-difluoroethoxy)ethylamino]methyl]thiophen-2-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[5-[[2-(2,2-difluoroethoxy)ethylamino]methyl]thiophen-2-yl]acetate |
| PubChem CID | 103083079 |
| Molecular Formula | C12H17F2NO3S |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | methyl 2-[5-[[2-(2,2-difluoroethoxy)ethylamino]methyl]thiophen-2-yl]acetate |
| SMILES | COC(=O)Cc1ccc(CNCCOCC(F)F)s1 |
| InChI | InChI=1S/C12H17F2NO3S/c1-17-12(16)6-9-2-3-10(19-9)7-15-4-5-18-8-11(13)14/h2-3,11,15H,4-8H2,1H3 |
| InChIKey | YNNCVGWFMWMZBL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[5-[[2-(2,2-difluoroethoxy)ethylamino]methyl]thiophen-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[5-[[2-(2,2-difluoroethoxy)ethylamino]methyl]thiophen-2-yl]acetate?
The IUPAC name of methyl 2-[5-[[2-(2,2-difluoroethoxy)ethylamino]methyl]thiophen-2-yl]acetate (CID 103083079) is methyl 2-[5-[[2-(2,2-difluoroethoxy)ethylamino]methyl]thiophen-2-yl]acetate.
What is the SMILES notation for methyl 2-[5-[[2-(2,2-difluoroethoxy)ethylamino]methyl]thiophen-2-yl]acetate?
The canonical SMILES for methyl 2-[5-[[2-(2,2-difluoroethoxy)ethylamino]methyl]thiophen-2-yl]acetate is COC(=O)Cc1ccc(CNCCOCC(F)F)s1.
What is the InChIKey of methyl 2-[5-[[2-(2,2-difluoroethoxy)ethylamino]methyl]thiophen-2-yl]acetate?
The InChIKey is YNNCVGWFMWMZBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F2NO3S/c1-17-12(16)6-9-2-3-10(19-9)7-15-4-5-18-8-11(13)14/h2-3,11,15H,4-8H2,1H3.
What are the key properties of methyl 2-[5-[[2-(2,2-difluoroethoxy)ethylamino]methyl]thiophen-2-yl]acetate?
methyl 2-[5-[[2-(2,2-difluoroethoxy)ethylamino]methyl]thiophen-2-yl]acetate has a molecular weight of 293.33 g/mol, XLogP of 1.83, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[5-[[2-(2,2-difluoroethoxy)ethylamino]methyl]thiophen-2-yl]acetate is sourced from PubChem (CID 103083079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).