C13H14BrN3 — CID 103083620
3-[amino-(4-bromo-2-methylphenyl)methyl]pyridin-4-amine (PubChem CID 103083620) has the molecular formula C13H14BrN3 and a molecular weight of 292.18 g/mol. Its IUPAC name is 3-[amino-(4-bromo-2-methylphenyl)methyl]pyridin-4-amine.
| Compound Name | 3-[amino-(4-bromo-2-methylphenyl)methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 103083620 |
| Molecular Formula | C13H14BrN3 |
| Molecular Weight | 292.18 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 3-[amino-(4-bromo-2-methylphenyl)methyl]pyridin-4-amine |
| SMILES | Cc1cc(Br)ccc1C(N)c1cnccc1N |
| InChI | InChI=1S/C13H14BrN3/c1-8-6-9(14)2-3-10(8)13(16)11-7-17-5-4-12(11)15/h2-7,13H,16H2,1H3,(H2,15,17) |
| InChIKey | ATDQGOUSKLVRSR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.18 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |