C14H17BrN2O2 — CID 103084073
1-[3-(4-bromo-2-methylphenyl)-1,2,4-oxadiazol-5-yl]pentan-2-ol (PubChem CID 103084073) has the molecular formula C14H17BrN2O2 and a molecular weight of 325.21 g/mol. Its IUPAC name is 1-[3-(4-bromo-2-methylphenyl)-1,2,4-oxadiazol-5-yl]pentan-2-ol.
| Compound Name | 1-[3-(4-bromo-2-methylphenyl)-1,2,4-oxadiazol-5-yl]pentan-2-ol |
|---|---|
| PubChem CID | 103084073 |
| Molecular Formula | C14H17BrN2O2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 1-[3-(4-bromo-2-methylphenyl)-1,2,4-oxadiazol-5-yl]pentan-2-ol |
| SMILES | CCCC(O)Cc1nc(-c2ccc(Br)cc2C)no1 |
| InChI | InChI=1S/C14H17BrN2O2/c1-3-4-11(18)8-13-16-14(17-19-13)12-6-5-10(15)7-9(12)2/h5-7,11,18H,3-4,8H2,1-2H3 |
| InChIKey | IPTZUDZGEXVZSR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |