C16H21N3OS — CID 10308447
cis-(1R,2R)-2-[(3-aminophenyl)sulfanylmethyl]-N-(cyanomethyl)cyclohexane-1-carboxamide (PubChem CID 10308447) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is cis-(1R,2R)-2-[(3-aminophenyl)sulfanylmethyl]-N-(cyanomethyl)cyclohexane-1-carboxamide.
| Compound Name | cis-(1R,2R)-2-[(3-aminophenyl)sulfanylmethyl]-N-(cyanomethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 10308447 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | cis-(1R,2R)-2-[(3-aminophenyl)sulfanylmethyl]-N-(cyanomethyl)cyclohexane-1-carboxamide |
| SMILES | N#CCNC(=O)[C@@H]1CCCC[C@H]1CSc1cccc(N)c1 |
| InChI | InChI=1S/C16H21N3OS/c17-8-9-19-16(20)15-7-2-1-4-12(15)11-21-14-6-3-5-13(18)10-14/h3,5-6,10,12,15H,1-2,4,7,9,11,18H2,(H,19,20)/t12-,15+/m0/s1 |
| InChIKey | XGVPHSZQGMEESH-SWLSCSKDSA-N |
| XLogP | 2.81 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|