C9H6Cl2F2N4 — CID 103084640
1-(2-chloro-4,6-difluorophenyl)-5-(1-chloroethyl)tetrazole (PubChem CID 103084640) has the molecular formula C9H6Cl2F2N4 and a molecular weight of 279.08 g/mol. Its IUPAC name is 1-(2-chloro-4,6-difluorophenyl)-5-(1-chloroethyl)tetrazole.
| Compound Name | 1-(2-chloro-4,6-difluorophenyl)-5-(1-chloroethyl)tetrazole |
|---|---|
| PubChem CID | 103084640 |
| Molecular Formula | C9H6Cl2F2N4 |
| Molecular Weight | 279.08 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | 1-(2-chloro-4,6-difluorophenyl)-5-(1-chloroethyl)tetrazole |
| SMILES | CC(Cl)c1nnnn1-c1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C9H6Cl2F2N4/c1-4(10)9-14-15-16-17(9)8-6(11)2-5(12)3-7(8)13/h2-4H,1H3 |
| InChIKey | ROTIXVTZMNYTHA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.08 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|