C14H6F5N3 — CID 10308505
2-[1-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-yl]pyridine (PubChem CID 10308505) has the molecular formula C14H6F5N3 and a molecular weight of 311.21 g/mol. Its IUPAC name is 2-[1-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-yl]pyridine.
| Compound Name | 2-[1-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-yl]pyridine |
|---|---|
| PubChem CID | 10308505 |
| Molecular Formula | C14H6F5N3 |
| Molecular Weight | 311.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 2-[1-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-yl]pyridine |
| SMILES | Fc1c(F)c(F)c(-n2ccc(-c3ccccn3)n2)c(F)c1F |
| InChI | InChI=1S/C14H6F5N3/c15-9-10(16)12(18)14(13(19)11(9)17)22-6-4-8(21-22)7-3-1-2-5-20-7/h1-6H |
| InChIKey | XNEHRZTXLKVXFE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.21 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|