C12H17N5O2 — CID 103085062
1-[1-(3,5-dimethoxyphenyl)tetrazol-5-yl]-N-methylethanamine (PubChem CID 103085062) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 1-[1-(3,5-dimethoxyphenyl)tetrazol-5-yl]-N-methylethanamine.
| Compound Name | 1-[1-(3,5-dimethoxyphenyl)tetrazol-5-yl]-N-methylethanamine |
|---|---|
| PubChem CID | 103085062 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 1-[1-(3,5-dimethoxyphenyl)tetrazol-5-yl]-N-methylethanamine |
| SMILES | CNC(C)c1nnnn1-c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C12H17N5O2/c1-8(13-2)12-14-15-16-17(12)9-5-10(18-3)7-11(6-9)19-4/h5-8,13H,1-4H3 |
| InChIKey | RAUWBCJTTPFMPE-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |