About 1-[(2E)-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-2-phenylmethoxyiminoethyl]pyrrolidin-2-one
1-[(2E)-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-2-phenylmethoxyiminoethyl]pyrrolidin-2-one (PubChem CID 10308652) has the molecular formula C19H25N3O2
and a molecular weight of 327.43 g/mol. Its IUPAC name is 1-[(2E)-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-2-phenylmethoxyiminoethyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-[(2E)-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-2-phenylmethoxyiminoethyl]pyrrolidin-2-one |
| PubChem CID | 10308652 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 1-[(2E)-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-2-phenylmethoxyiminoethyl]pyrrolidin-2-one |
| SMILES | CN1CCC=C(/C(CN2CCCC2=O)=N\OCc2ccccc2)C1 |
| InChI | InChI=1S/C19H25N3O2/c1-21-11-5-9-17(13-21)18(14-22-12-6-10-19(22)23)20-24-15-16-7-3-2-4-8-16/h2-4,7-9H,5-6,10-15H2,1H3/b20-18- |
| InChIKey | RSAVZPNEFOYFDT-ZZEZOPTASA-N |
| XLogP | 2.44 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2E)-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-2-phenylmethoxyiminoethyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2E)-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-2-phenylmethoxyiminoethyl]pyrrolidin-2-one?
The IUPAC name of 1-[(2E)-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-2-phenylmethoxyiminoethyl]pyrrolidin-2-one (CID 10308652) is 1-[(2E)-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-2-phenylmethoxyiminoethyl]pyrrolidin-2-one.
What is the SMILES notation for 1-[(2E)-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-2-phenylmethoxyiminoethyl]pyrrolidin-2-one?
The canonical SMILES for 1-[(2E)-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-2-phenylmethoxyiminoethyl]pyrrolidin-2-one is CN1CCC=C(/C(CN2CCCC2=O)=N\OCc2ccccc2)C1.
What is the InChIKey of 1-[(2E)-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-2-phenylmethoxyiminoethyl]pyrrolidin-2-one?
The InChIKey is RSAVZPNEFOYFDT-ZZEZOPTASA-N. The full InChI is InChI=1S/C19H25N3O2/c1-21-11-5-9-17(13-21)18(14-22-12-6-10-19(22)23)20-24-15-16-7-3-2-4-8-16/h2-4,7-9H,5-6,10-15H2,1H3/b20-18-.
What are the key properties of 1-[(2E)-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-2-phenylmethoxyiminoethyl]pyrrolidin-2-one?
1-[(2E)-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-2-phenylmethoxyiminoethyl]pyrrolidin-2-one has a molecular weight of 327.43 g/mol, XLogP of 2.44, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2E)-2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-2-phenylmethoxyiminoethyl]pyrrolidin-2-one is sourced from PubChem (CID 10308652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).