About 4-[(4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-yl)amino]benzoic acid
4-[(4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-yl)amino]benzoic acid (PubChem CID 10308706) has the molecular formula C17H12N6O2
and a molecular weight of 332.32 g/mol. Its IUPAC name is 4-[(4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-yl)amino]benzoic acid.
Molecular Properties
| Compound Name | 4-[(4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-yl)amino]benzoic acid |
| PubChem CID | 10308706 |
| Molecular Formula | C17H12N6O2 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 4-[(4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-yl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2nccc(-c3cnn4ncccc34)n2)cc1 |
| InChI | InChI=1S/C17H12N6O2/c24-16(25)11-3-5-12(6-4-11)21-17-18-9-7-14(22-17)13-10-20-23-15(13)2-1-8-19-23/h1-10H,(H,24,25)(H,18,21,22) |
| InChIKey | VSZVMUGJWVQEOS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[(4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-yl)amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-yl)amino]benzoic acid?
The IUPAC name of 4-[(4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-yl)amino]benzoic acid (CID 10308706) is 4-[(4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-yl)amino]benzoic acid.
What is the SMILES notation for 4-[(4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-yl)amino]benzoic acid?
The canonical SMILES for 4-[(4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-yl)amino]benzoic acid is O=C(O)c1ccc(Nc2nccc(-c3cnn4ncccc34)n2)cc1.
What is the InChIKey of 4-[(4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-yl)amino]benzoic acid?
The InChIKey is VSZVMUGJWVQEOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N6O2/c24-16(25)11-3-5-12(6-4-11)21-17-18-9-7-14(22-17)13-10-20-23-15(13)2-1-8-19-23/h1-10H,(H,24,25)(H,18,21,22).
What are the key properties of 4-[(4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-yl)amino]benzoic acid?
4-[(4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-yl)amino]benzoic acid has a molecular weight of 332.32 g/mol, XLogP of 2.63, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-yl)amino]benzoic acid is sourced from PubChem (CID 10308706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).